Home » In the following reaction, identify the salt formed Acids Bases and Salts MCQs In the following reaction, identify the salt formed December 28, 2021 12 Views Q. In the following reaction, identify the salt formed NH4OH (aq) + H2SO4 (aq) → _____ + 2H2O (l) NH4NO3(NH4)2SO4(NH4)3PO4(NH4)2S Answer: (NH4)2SO4
During the preparation of hydrogen chloride gas on a humid day, the gas is usually passed through the guard tube containing calcium chloride. The role of calcium chloride taken in the guard tube is to
Sodium hydrogen carbonate when added to acetic acid evolves a gas. Which of the following statements are true about the gas evolved?